About 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide
2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide (PubChem CID 21179437) has the molecular formula C18H18BrN2OS-
and a molecular weight of 390.33 g/mol. Its IUPAC name is 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide.
Molecular Properties
| Compound Name | 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide |
| PubChem CID | 21179437 |
| Molecular Formula | C18H18BrN2OS- |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide |
| SMILES | O=C(CN(Cc1ccccc1)C1=NCCS1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C18H18N2OS.BrH/c21-17(16-9-5-2-6-10-16)14-20(18-19-11-12-22-18)13-15-7-3-1-4-8-15;/h1-10H,11-14H2;1H/p-1 |
| InChIKey | QHXBKBJSLBNVAI-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide?
The IUPAC name of 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide (CID 21179437) is 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide.
What is the SMILES notation for 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide?
The canonical SMILES for 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide is O=C(CN(Cc1ccccc1)C1=NCCS1)c1ccccc1.[Br-].
What is the InChIKey of 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide?
The InChIKey is QHXBKBJSLBNVAI-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H18N2OS.BrH/c21-17(16-9-5-2-6-10-16)14-20(18-19-11-12-22-18)13-15-7-3-1-4-8-15;/h1-10H,11-14H2;1H/p-1.
What are the key properties of 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide?
2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide has a molecular weight of 390.33 g/mol, XLogP of 0.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl(4,5-dihydro-1,3-thiazol-2-yl)amino]-1-phenylethanone bromide is sourced from PubChem (CID 21179437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).