C18H19BrN2OS — CID 12005521
2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide (PubChem CID 12005521) has the molecular formula C18H19BrN2OS and a molecular weight of 391.33 g/mol. Its IUPAC name is 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide.
| Compound Name | 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide |
|---|---|
| PubChem CID | 12005521 |
| Molecular Formula | C18H19BrN2OS |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide |
| SMILES | Br.O=C(CN1CCS/C1=N\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2OS.BrH/c21-17(16-9-5-2-6-10-16)14-20-11-12-22-18(20)19-13-15-7-3-1-4-8-15;/h1-10H,11-14H2;1H/b19-18-; |
| InChIKey | GTECZZIEHURJBL-TVWXOORISA-N |
| XLogP | 4.05 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|