C18H18BrClN2OS — CID 12005515
2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(4-chlorophenyl)ethanone;hydrobromide (PubChem CID 12005515) has the molecular formula C18H18BrClN2OS and a molecular weight of 425.78 g/mol. Its IUPAC name is 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(4-chlorophenyl)ethanone;hydrobromide.
| Compound Name | 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(4-chlorophenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 12005515 |
| Molecular Formula | C18H18BrClN2OS |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(4-chlorophenyl)ethanone;hydrobromide |
| SMILES | Br.O=C(CN1CCS/C1=N\Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2OS.BrH/c19-16-8-6-15(7-9-16)17(22)13-21-10-11-23-18(21)20-12-14-4-2-1-3-5-14;/h1-9H,10-13H2;1H/b20-18-; |
| InChIKey | RBTNUYUHWMJLBD-GQQUDWLYSA-N |
| XLogP | 4.71 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|