C13H17BrN2OS — CID 15944810
1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone;hydrobromide (PubChem CID 15944810) has the molecular formula C13H17BrN2OS and a molecular weight of 329.26 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone;hydrobromide.
| Compound Name | 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 15944810 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=C1\SCCN1CC(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C13H16N2OS.BrH/c1-2-10-3-5-11(6-4-10)12(16)9-15-7-8-17-13(15)14;/h3-6,14H,2,7-9H2,1H3;1H/b14-13-; |
| InChIKey | BFWULPZAUJHWNE-HPWRNOGASA-N |
| XLogP | 2.99 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|