C10H10N2OS — CID 6425269
N-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide (PubChem CID 6425269) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is N-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide.
| Compound Name | N-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 6425269 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=NCCS1 |
| InChI | InChI=1S/C10H10N2OS/c13-9(10-11-6-7-14-10)12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) |
| InChIKey | MCTXZWKSDGYMBU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |