C15H13NO3S — CID 19811964
6-[hydroxy-(4-methoxyphenyl)methyl]-3H-1,3-benzothiazol-2-one (PubChem CID 19811964) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 6-[hydroxy-(4-methoxyphenyl)methyl]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[hydroxy-(4-methoxyphenyl)methyl]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 19811964 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 6-[hydroxy-(4-methoxyphenyl)methyl]-3H-1,3-benzothiazol-2-one |
| SMILES | COc1ccc(C(O)c2ccc3[nH]c(=O)sc3c2)cc1 |
| InChI | InChI=1S/C15H13NO3S/c1-19-11-5-2-9(3-6-11)14(17)10-4-7-12-13(8-10)20-15(18)16-12/h2-8,14,17H,1H3,(H,16,18) |
| InChIKey | GJUXTRYLBIWNLU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |