C21H13NO3S — CID 15476449
2-methoxy-5H-naphtho[2,3-c]phenothiazine-8,13-dione (PubChem CID 15476449) has the molecular formula C21H13NO3S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-methoxy-5H-naphtho[2,3-c]phenothiazine-8,13-dione.
| Compound Name | 2-methoxy-5H-naphtho[2,3-c]phenothiazine-8,13-dione |
|---|---|
| PubChem CID | 15476449 |
| Molecular Formula | C21H13NO3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-methoxy-5H-naphtho[2,3-c]phenothiazine-8,13-dione |
| SMILES | COc1ccc2[nH]c3ccc4c(=O)c5ccccc5c(=O)c4c3sc2c1 |
| InChI | InChI=1S/C21H13NO3S/c1-25-11-6-8-15-17(10-11)26-21-16(22-15)9-7-14-18(21)20(24)13-5-3-2-4-12(13)19(14)23/h2-10,22H,1H3 |
| InChIKey | XWEMPYYKKXMIRK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|