C19H16N2O3S — CID 139572274
6-(2-hydroxyethylamino)-10-methoxythiochromeno[2,3-c]quinolin-12-one (PubChem CID 139572274) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)-10-methoxythiochromeno[2,3-c]quinolin-12-one.
| Compound Name | 6-(2-hydroxyethylamino)-10-methoxythiochromeno[2,3-c]quinolin-12-one |
|---|---|
| PubChem CID | 139572274 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 6-(2-hydroxyethylamino)-10-methoxythiochromeno[2,3-c]quinolin-12-one |
| SMILES | COc1ccc2sc3c(NCCO)nc4ccccc4c3c(=O)c2c1 |
| InChI | InChI=1S/C19H16N2O3S/c1-24-11-6-7-15-13(10-11)17(23)16-12-4-2-3-5-14(12)21-19(18(16)25-15)20-8-9-22/h2-7,10,22H,8-9H2,1H3,(H,20,21) |
| InChIKey | GVXJRBIDHPKTJE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|