C19H23ClN4O3 — CID 52995704
3-[[2-(2,4-dimethoxyanilino)quinazolin-4-yl]amino]propan-1-ol;hydrochloride (PubChem CID 52995704) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-[[2-(2,4-dimethoxyanilino)quinazolin-4-yl]amino]propan-1-ol;hydrochloride.
| Compound Name | 3-[[2-(2,4-dimethoxyanilino)quinazolin-4-yl]amino]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 52995704 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3-[[2-(2,4-dimethoxyanilino)quinazolin-4-yl]amino]propan-1-ol;hydrochloride |
| SMILES | COc1ccc(Nc2nc(NCCCO)c3ccccc3n2)c(OC)c1.Cl |
| InChI | InChI=1S/C19H22N4O3.ClH/c1-25-13-8-9-16(17(12-13)26-2)22-19-21-15-7-4-3-6-14(15)18(23-19)20-10-5-11-24;/h3-4,6-9,12,24H,5,10-11H2,1-2H3,(H2,20,21,22,23);1H |
| InChIKey | HGEGHHFSKHLTBY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|