C22H27N5O2 — CID 10548612
2-N-(2,4-dimethoxyphenyl)-6-methyl-4-N-(4-phenylbutyl)-1,3,5-triazine-2,4-diamine (PubChem CID 10548612) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-N-(2,4-dimethoxyphenyl)-6-methyl-4-N-(4-phenylbutyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,4-dimethoxyphenyl)-6-methyl-4-N-(4-phenylbutyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10548612 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-N-(2,4-dimethoxyphenyl)-6-methyl-4-N-(4-phenylbutyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(C)nc(NCCCCc3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C22H27N5O2/c1-16-24-21(23-14-8-7-11-17-9-5-4-6-10-17)27-22(25-16)26-19-13-12-18(28-2)15-20(19)29-3/h4-6,9-10,12-13,15H,7-8,11,14H2,1-3H3,(H2,23,24,25,26,27) |
| InChIKey | GSSHFSCMUSLRJS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|