C19H21ClN4O2 — CID 91963458
2-N-(5-chloro-2-methoxyphenyl)-4-N-(3-methoxypropyl)quinazoline-2,4-diamine (PubChem CID 91963458) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 2-N-(5-chloro-2-methoxyphenyl)-4-N-(3-methoxypropyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-(5-chloro-2-methoxyphenyl)-4-N-(3-methoxypropyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91963458 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-N-(5-chloro-2-methoxyphenyl)-4-N-(3-methoxypropyl)quinazoline-2,4-diamine |
| SMILES | COCCCNc1nc(Nc2cc(Cl)ccc2OC)nc2ccccc12 |
| InChI | InChI=1S/C19H21ClN4O2/c1-25-11-5-10-21-18-14-6-3-4-7-15(14)22-19(24-18)23-16-12-13(20)8-9-17(16)26-2/h3-4,6-9,12H,5,10-11H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | BBMLSGJOJHLEIN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|