C9H7BrN2S2 — CID 28805751
5-amino-4-(4-bromophenyl)-3H-1,3-thiazole-2-thione (PubChem CID 28805751) has the molecular formula C9H7BrN2S2 and a molecular weight of 287.21 g/mol. Its IUPAC name is 5-amino-4-(4-bromophenyl)-3H-1,3-thiazole-2-thione.
| Compound Name | 5-amino-4-(4-bromophenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 28805751 |
| Molecular Formula | C9H7BrN2S2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 285.92 |
| IUPAC Name | 5-amino-4-(4-bromophenyl)-3H-1,3-thiazole-2-thione |
| SMILES | Nc1sc(=S)[nH]c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrN2S2/c10-6-3-1-5(2-4-6)7-8(11)14-9(13)12-7/h1-4H,11H2,(H,12,13) |
| InChIKey | KKVXPNSYRVCFNV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|