C14H17NS2 — CID 82362733
4-(4-tert-butylphenyl)-5-methyl-3H-1,3-thiazole-2-thione (PubChem CID 82362733) has the molecular formula C14H17NS2 and a molecular weight of 263.43 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-5-methyl-3H-1,3-thiazole-2-thione.
| Compound Name | 4-(4-tert-butylphenyl)-5-methyl-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 82362733 |
| Molecular Formula | C14H17NS2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-(4-tert-butylphenyl)-5-methyl-3H-1,3-thiazole-2-thione |
| SMILES | Cc1sc(=S)[nH]c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H17NS2/c1-9-12(15-13(16)17-9)10-5-7-11(8-6-10)14(2,3)4/h5-8H,1-4H3,(H,15,16) |
| InChIKey | GWAOHWMPQDHJSF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|