C16H12Br2N2S — CID 141233821
2,5-bis(4-bromophenyl)thiophene-3,4-diamine (PubChem CID 141233821) has the molecular formula C16H12Br2N2S and a molecular weight of 424.16 g/mol. Its IUPAC name is 2,5-bis(4-bromophenyl)thiophene-3,4-diamine.
| Compound Name | 2,5-bis(4-bromophenyl)thiophene-3,4-diamine |
|---|---|
| PubChem CID | 141233821 |
| Molecular Formula | C16H12Br2N2S |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 421.91 |
| IUPAC Name | 2,5-bis(4-bromophenyl)thiophene-3,4-diamine |
| SMILES | Nc1c(-c2ccc(Br)cc2)sc(-c2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C16H12Br2N2S/c17-11-5-1-9(2-6-11)15-13(19)14(20)16(21-15)10-3-7-12(18)8-4-10/h1-8H,19-20H2 |
| InChIKey | WDMJBDRIWRBLFJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |