About 4-bromoaniline;hydroiodide
4-bromoaniline;hydroiodide (PubChem CID 175433533) has the molecular formula C6H7BrIN
and a molecular weight of 299.94 g/mol. Its IUPAC name is 4-bromoaniline;hydroiodide.
Molecular Properties
| Compound Name | 4-bromoaniline;hydroiodide |
| PubChem CID | 175433533 |
| Molecular Formula | C6H7BrIN |
| Molecular Weight | 299.94 g/mol |
| Exact Mass | 298.88 |
| IUPAC Name | 4-bromoaniline;hydroiodide |
| SMILES | I.Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C6H6BrN.HI/c7-5-1-3-6(8)4-2-5;/h1-4H,8H2;1H |
| InChIKey | GRNKUTDFMIMTCE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.94 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromoaniline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromoaniline;hydroiodide?
The IUPAC name of 4-bromoaniline;hydroiodide (CID 175433533) is 4-bromoaniline;hydroiodide.
What is the SMILES notation for 4-bromoaniline;hydroiodide?
The canonical SMILES for 4-bromoaniline;hydroiodide is I.Nc1ccc(Br)cc1.
What is the InChIKey of 4-bromoaniline;hydroiodide?
The InChIKey is GRNKUTDFMIMTCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN.HI/c7-5-1-3-6(8)4-2-5;/h1-4H,8H2;1H.
What are the key properties of 4-bromoaniline;hydroiodide?
4-bromoaniline;hydroiodide has a molecular weight of 299.94 g/mol, XLogP of 2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromoaniline;hydroiodide is sourced from PubChem (CID 175433533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).