About 4-bromoaniline;N-methylmethanesulfinamide
4-bromoaniline;N-methylmethanesulfinamide (PubChem CID 145017292) has the molecular formula C8H13BrN2OS
and a molecular weight of 265.18 g/mol. Its IUPAC name is 4-bromoaniline;N-methylmethanesulfinamide.
Molecular Properties
| Compound Name | 4-bromoaniline;N-methylmethanesulfinamide |
| PubChem CID | 145017292 |
| Molecular Formula | C8H13BrN2OS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 4-bromoaniline;N-methylmethanesulfinamide |
| SMILES | CNS(C)=O.Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C6H6BrN.C2H7NOS/c7-5-1-3-6(8)4-2-5;1-3-5(2)4/h1-4H,8H2;3H,1-2H3 |
| InChIKey | RVUJEICQMGTWJE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromoaniline;N-methylmethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromoaniline;N-methylmethanesulfinamide?
The IUPAC name of 4-bromoaniline;N-methylmethanesulfinamide (CID 145017292) is 4-bromoaniline;N-methylmethanesulfinamide.
What is the SMILES notation for 4-bromoaniline;N-methylmethanesulfinamide?
The canonical SMILES for 4-bromoaniline;N-methylmethanesulfinamide is CNS(C)=O.Nc1ccc(Br)cc1.
What is the InChIKey of 4-bromoaniline;N-methylmethanesulfinamide?
The InChIKey is RVUJEICQMGTWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN.C2H7NOS/c7-5-1-3-6(8)4-2-5;1-3-5(2)4/h1-4H,8H2;3H,1-2H3.
What are the key properties of 4-bromoaniline;N-methylmethanesulfinamide?
4-bromoaniline;N-methylmethanesulfinamide has a molecular weight of 265.18 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromoaniline;N-methylmethanesulfinamide is sourced from PubChem (CID 145017292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).