C9H12BrNO — CID 84736110
2-bromo-5-methoxy-3,6-dimethylaniline (PubChem CID 84736110) has the molecular formula C9H12BrNO and a molecular weight of 230.10 g/mol. Its IUPAC name is 2-bromo-5-methoxy-3,6-dimethylaniline.
| Compound Name | 2-bromo-5-methoxy-3,6-dimethylaniline |
|---|---|
| PubChem CID | 84736110 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-bromo-5-methoxy-3,6-dimethylaniline |
| SMILES | COc1cc(C)c(Br)c(N)c1C |
| InChI | InChI=1S/C9H12BrNO/c1-5-4-7(12-3)6(2)9(11)8(5)10/h4H,11H2,1-3H3 |
| InChIKey | KQWQFQIUKWOVHX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|