C14H24ClNO3 — CID 170889525
1-(2,3,4-trimethoxy-6-methylphenyl)butan-2-amine;hydrochloride (PubChem CID 170889525) has the molecular formula C14H24ClNO3 and a molecular weight of 289.80 g/mol. Its IUPAC name is 1-(2,3,4-trimethoxy-6-methylphenyl)butan-2-amine;hydrochloride.
| Compound Name | 1-(2,3,4-trimethoxy-6-methylphenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889525 |
| Molecular Formula | C14H24ClNO3 |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(2,3,4-trimethoxy-6-methylphenyl)butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1c(C)cc(OC)c(OC)c1OC.Cl |
| InChI | InChI=1S/C14H23NO3.ClH/c1-6-10(15)8-11-9(2)7-12(16-3)14(18-5)13(11)17-4;/h7,10H,6,8,15H2,1-5H3;1H |
| InChIKey | WAZNISJHCFUZOF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |