C15H24FNO3 — CID 144811327
1-[3-(3-fluoro-4,5-dimethoxyphenyl)propyl]azetidine;methanol (PubChem CID 144811327) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is 1-[3-(3-fluoro-4,5-dimethoxyphenyl)propyl]azetidine;methanol.
| Compound Name | 1-[3-(3-fluoro-4,5-dimethoxyphenyl)propyl]azetidine;methanol |
|---|---|
| PubChem CID | 144811327 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[3-(3-fluoro-4,5-dimethoxyphenyl)propyl]azetidine;methanol |
| SMILES | CO.COc1cc(CCCN2CCC2)cc(F)c1OC |
| InChI | InChI=1S/C14H20FNO2.CH4O/c1-17-13-10-11(9-12(15)14(13)18-2)5-3-6-16-7-4-8-16;1-2/h9-10H,3-8H2,1-2H3;2H,1H3 |
| InChIKey | BPYQSNWSOKGPLF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |