C17H28N2O4 — CID 134105359
1-methyl-4-[2-[(3,4,5-trimethoxyphenyl)methoxy]ethyl]piperazine (PubChem CID 134105359) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-methyl-4-[2-[(3,4,5-trimethoxyphenyl)methoxy]ethyl]piperazine.
| Compound Name | 1-methyl-4-[2-[(3,4,5-trimethoxyphenyl)methoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 134105359 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-methyl-4-[2-[(3,4,5-trimethoxyphenyl)methoxy]ethyl]piperazine |
| SMILES | COc1cc(COCCN2CCN(C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H28N2O4/c1-18-5-7-19(8-6-18)9-10-23-13-14-11-15(20-2)17(22-4)16(12-14)21-3/h11-12H,5-10,13H2,1-4H3 |
| InChIKey | QNVCOVMONGRGCS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|