C34H45F2N3O2 — CID 11398927
1-(4-amino-2,3,5-trimethylphenoxy)-3-[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]propan-2-ol (PubChem CID 11398927) has the molecular formula C34H45F2N3O2 and a molecular weight of 565.75 g/mol. Its IUPAC name is 1-(4-amino-2,3,5-trimethylphenoxy)-3-[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(4-amino-2,3,5-trimethylphenoxy)-3-[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 11398927 |
| Molecular Formula | C34H45F2N3O2 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | 1-(4-amino-2,3,5-trimethylphenoxy)-3-[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]propan-2-ol |
| SMILES | Cc1cc(OCC(O)CN2CCN(CCCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c(C)c(C)c1N |
| InChI | InChI=1S/C34H45F2N3O2/c1-24-21-33(25(2)26(3)34(24)37)41-23-31(40)22-39-19-17-38(18-20-39)16-6-4-5-7-32(27-8-12-29(35)13-9-27)28-10-14-30(36)15-11-28/h8-15,21,31-32,40H,4-7,16-20,22-23,37H2,1-3H3 |
| InChIKey | OUGOONSOCAIFKF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|