C10H11F3O3S — CID 68686622
[3,4-dimethoxy-5-(trifluoromethylsulfanyl)phenyl]methanol (PubChem CID 68686622) has the molecular formula C10H11F3O3S and a molecular weight of 268.26 g/mol. Its IUPAC name is [3,4-dimethoxy-5-(trifluoromethylsulfanyl)phenyl]methanol.
| Compound Name | [3,4-dimethoxy-5-(trifluoromethylsulfanyl)phenyl]methanol |
|---|---|
| PubChem CID | 68686622 |
| Molecular Formula | C10H11F3O3S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | [3,4-dimethoxy-5-(trifluoromethylsulfanyl)phenyl]methanol |
| SMILES | COc1cc(CO)cc(SC(F)(F)F)c1OC |
| InChI | InChI=1S/C10H11F3O3S/c1-15-7-3-6(5-14)4-8(9(7)16-2)17-10(11,12)13/h3-4,14H,5H2,1-2H3 |
| InChIKey | OPOBZNOLTXCBFG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |