C12H18O3S — CID 15044964
(3-methoxy-5-methylsulfanyl-4-propoxyphenyl)methanol (PubChem CID 15044964) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is (3-methoxy-5-methylsulfanyl-4-propoxyphenyl)methanol.
| Compound Name | (3-methoxy-5-methylsulfanyl-4-propoxyphenyl)methanol |
|---|---|
| PubChem CID | 15044964 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (3-methoxy-5-methylsulfanyl-4-propoxyphenyl)methanol |
| SMILES | CCCOc1c(OC)cc(CO)cc1SC |
| InChI | InChI=1S/C12H18O3S/c1-4-5-15-12-10(14-2)6-9(8-13)7-11(12)16-3/h6-7,13H,4-5,8H2,1-3H3 |
| InChIKey | JAFFBBOJWHNWMM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |