C9H13BO5 — CID 54470355
[4-(hydroxymethyl)-2,6-dimethoxyphenyl]boronic acid (PubChem CID 54470355) has the molecular formula C9H13BO5 and a molecular weight of 212.01 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2,6-dimethoxyphenyl]boronic acid.
| Compound Name | [4-(hydroxymethyl)-2,6-dimethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 54470355 |
| Molecular Formula | C9H13BO5 |
| Molecular Weight | 212.01 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | [4-(hydroxymethyl)-2,6-dimethoxyphenyl]boronic acid |
| SMILES | COc1cc(CO)cc(OC)c1B(O)O |
| InChI | InChI=1S/C9H13BO5/c1-14-7-3-6(5-11)4-8(15-2)9(7)10(12)13/h3-4,11-13H,5H2,1-2H3 |
| InChIKey | XHWYOFFQNUKCDB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.01 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|