C15H16O4 — CID 22669970
4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]phenol (PubChem CID 22669970) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]phenol.
| Compound Name | 4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]phenol |
|---|---|
| PubChem CID | 22669970 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]phenol |
| SMILES | COc1cc(CO)cc(OC)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O4/c1-18-13-7-10(9-16)8-14(19-2)15(13)11-3-5-12(17)6-4-11/h3-8,16-17H,9H2,1-2H3 |
| InChIKey | ZXTGZPNGLIKANY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |