C23H24O6 — CID 174906852
(3,4-dimethoxyphenyl)methanol;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 174906852) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methanol;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | (3,4-dimethoxyphenyl)methanol;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 174906852 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (3,4-dimethoxyphenyl)methanol;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | COc1ccc(CO)cc1OC.Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3.C9H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11;1-11-8-4-3-7(6-10)5-9(8)12-2/h1-9,15-17H;3-5,10H,6H2,1-2H3 |
| InChIKey | PVQGCTDXYKPNEV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|