C13H20BNO5 — CID 18667758
[2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid (PubChem CID 18667758) has the molecular formula C13H20BNO5 and a molecular weight of 281.12 g/mol. Its IUPAC name is [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid.
| Compound Name | [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 18667758 |
| Molecular Formula | C13H20BNO5 |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid |
| SMILES | COc1cc(CN2CCOCC2)cc(OC)c1B(O)O |
| InChI | InChI=1S/C13H20BNO5/c1-18-11-7-10(9-15-3-5-20-6-4-15)8-12(19-2)13(11)14(16)17/h7-8,16-17H,3-6,9H2,1-2H3 |
| InChIKey | MKTRYOGYDBKWKM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|