[2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid

C13H20BNO5 — CID 18667758

IUPAC[2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid
SMILESCOc1cc(CN2CCOCC2)cc(OC)c1B(O)O
InChIInChI=1S/C13H20BNO5/c1-18-11-7-10(9-15-3-5-20-6-4-15)8-12(19-2)13(11)14(16)17/h7-8,16-17H,3-6,9H2,1-2H3
InChIKeyMKTRYOGYDBKWKM-UHFFFAOYSA-N
MW281.12 g/mol
LogP-0.78
Rot. Bonds5

About [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid

[2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid (PubChem CID 18667758) has the molecular formula C13H20BNO5 and a molecular weight of 281.12 g/mol. Its IUPAC name is [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid.

Molecular Properties

Compound Name[2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid
PubChem CID18667758
Molecular FormulaC13H20BNO5
Molecular Weight281.12 g/mol
Exact Mass281.14
IUPAC Name[2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid
SMILESCOc1cc(CN2CCOCC2)cc(OC)c1B(O)O
InChIInChI=1S/C13H20BNO5/c1-18-11-7-10(9-15-3-5-20-6-4-15)8-12(19-2)13(11)14(16)17/h7-8,16-17H,3-6,9H2,1-2H3
InChIKeyMKTRYOGYDBKWKM-UHFFFAOYSA-N
XLogP-0.78
TPSA71.39 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.12
LogP ≤ 5-0.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid?
The IUPAC name of [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid (CID 18667758) is [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid.
What is the SMILES notation for [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid?
The canonical SMILES for [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid is COc1cc(CN2CCOCC2)cc(OC)c1B(O)O.
What is the InChIKey of [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid?
The InChIKey is MKTRYOGYDBKWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BNO5/c1-18-11-7-10(9-15-3-5-20-6-4-15)8-12(19-2)13(11)14(16)17/h7-8,16-17H,3-6,9H2,1-2H3.
What are the key properties of [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid?
[2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid has a molecular weight of 281.12 g/mol, XLogP of -0.78, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethoxy-4-(morpholin-4-ylmethyl)phenyl]boronic acid is sourced from PubChem (CID 18667758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).