C11H17BO5 — CID 10236170
[4-(ethoxymethyl)-2,6-dimethoxyphenyl]boronic acid (PubChem CID 10236170) has the molecular formula C11H17BO5 and a molecular weight of 240.06 g/mol. Its IUPAC name is [4-(ethoxymethyl)-2,6-dimethoxyphenyl]boronic acid.
| Compound Name | [4-(ethoxymethyl)-2,6-dimethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 10236170 |
| Molecular Formula | C11H17BO5 |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | [4-(ethoxymethyl)-2,6-dimethoxyphenyl]boronic acid |
| SMILES | CCOCc1cc(OC)c(B(O)O)c(OC)c1 |
| InChI | InChI=1S/C11H17BO5/c1-4-17-7-8-5-9(15-2)11(12(13)14)10(6-8)16-3/h5-6,13-14H,4,7H2,1-3H3 |
| InChIKey | BCMKFWFNEMRLOO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|