C11H15NO2S — CID 106789106
4-(ethoxymethyl)-2-methoxybenzenecarbothioamide (PubChem CID 106789106) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(ethoxymethyl)-2-methoxybenzenecarbothioamide.
| Compound Name | 4-(ethoxymethyl)-2-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 106789106 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 4-(ethoxymethyl)-2-methoxybenzenecarbothioamide |
| SMILES | CCOCc1ccc(C(N)=S)c(OC)c1 |
| InChI | InChI=1S/C11H15NO2S/c1-3-14-7-8-4-5-9(11(12)15)10(6-8)13-2/h4-6H,3,7H2,1-2H3,(H2,12,15) |
| InChIKey | OQFBVWSGDSRSKD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|