C52H68O20 — CID 172870243
dimethyl (2S,3S)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate;dimethyl (2R,3R)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate (PubChem CID 172870243) has the molecular formula C52H68O20 and a molecular weight of 1013.10 g/mol. Its IUPAC name is dimethyl (2S,3S)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate;dimethyl (2R,3R)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate.
| Compound Name | dimethyl (2S,3S)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate;dimethyl (2R,3R)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate |
|---|---|
| PubChem CID | 172870243 |
| Molecular Formula | C52H68O20 |
| Molecular Weight | 1013.10 g/mol |
| Exact Mass | 1012.43 |
| IUPAC Name | dimethyl (2S,3S)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate;dimethyl (2R,3R)-2,3-bis[(3-hydroxy-4,5-dimethoxyphenyl)methyl]hexanedioate |
| SMILES | COC(=O)CC[C@@H](Cc1cc(O)c(OC)c(OC)c1)[C@H](Cc1cc(O)c(OC)c(OC)c1)C(=O)OC.COC(=O)CC[C@H](Cc1cc(O)c(OC)c(OC)c1)[C@@H](Cc1cc(O)c(OC)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/2C26H34O10/c2*1-31-21-13-15(11-19(27)24(21)34-4)9-17(7-8-23(29)33-3)18(26(30)36-6)10-16-12-20(28)25(35-5)22(14-16)32-2/h2*11-14,17-18,27-28H,7-10H2,1-6H3/t2*17-,18-/m10/s1 |
| InChIKey | NMFVBXMYQDSOEA-PTQCACIQSA-N |
| XLogP | 6.55 |
| TPSA | 259.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.10 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|