C8H8O6 — CID 45092881
2-hydroxy-2-(3,4,5-trihydroxyphenyl)acetic acid (PubChem CID 45092881) has the molecular formula C8H8O6 and a molecular weight of 200.15 g/mol. Its IUPAC name is 2-hydroxy-2-(3,4,5-trihydroxyphenyl)acetic acid.
| Compound Name | 2-hydroxy-2-(3,4,5-trihydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 45092881 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-hydroxy-2-(3,4,5-trihydroxyphenyl)acetic acid |
| SMILES | O=C(O)C(O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C8H8O6/c9-4-1-3(6(11)8(13)14)2-5(10)7(4)12/h1-2,6,9-12H,(H,13,14) |
| InChIKey | GKNXKVFCNOWHDA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|