C12H18NO3+ — CID 6325589
[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-trimethylazanium (PubChem CID 6325589) has the molecular formula C12H18NO3+ and a molecular weight of 224.28 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-trimethylazanium.
| Compound Name | [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-trimethylazanium |
|---|---|
| PubChem CID | 6325589 |
| Molecular Formula | C12H18NO3+ |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C12H17NO3/c1-13(2,3)11(12(15)16)8-9-4-6-10(14)7-5-9/h4-7,11H,8H2,1-3H3,(H-,14,15,16)/p+1/t11-/m0/s1 |
| InChIKey | KDVBLCRQNNLSIV-NSHDSACASA-O |
| XLogP | 1.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|