3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid

C9H10O5 — CID 139243425

IUPAC3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid
SMILESO=C(O)C(O)Cc1cc(O)cc(O)c1
InChIInChI=1S/C9H10O5/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8,10-12H,3H2,(H,13,14)
InChIKeyDFCPGQYAWGWUPH-UHFFFAOYSA-N
MW198.17 g/mol
LogP0.09
Rot. Bonds3

About 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid

3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid (PubChem CID 139243425) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid.

Molecular Properties

Compound Name3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid
PubChem CID139243425
Molecular FormulaC9H10O5
Molecular Weight198.17 g/mol
Exact Mass198.05
IUPAC Name3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid
SMILESO=C(O)C(O)Cc1cc(O)cc(O)c1
InChIInChI=1S/C9H10O5/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8,10-12H,3H2,(H,13,14)
InChIKeyDFCPGQYAWGWUPH-UHFFFAOYSA-N
XLogP0.09
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.17
LogP ≤ 50.09
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-hydroxypropanoic acid
CID 142778160
(2R)-2-hydroxy-3-phenylpropanoic acid;hydrochloride
CID 67010378
sodium;hydride;2-hydroxy-3-phenylpropanoic acid
CID 173185606
2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoic acid
CID 90820561
(2S)-3-(3-chlorophenyl)-2-hydroxypropanoic acid
CID 39240389
2-amino-3-[3-(2-fluoroethyl)-5-hydroxyphenyl]propanoic acid
CID 69488080
3-[(3,5-dihydroxybenzoyl)amino]-2-hydroxypropanoic acid
CID 107702673
(2R)-3-(4-benzylphenyl)-2-hydroxypropanoic acid
CID 150376143
(2S)-2-amino-3-phenylpropanoic acid;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid
CID 121320325
2-amino-3-(3-ethyl-5-hydroxyphenyl)propanoic acid
CID 117298569
(2R)-3-(5-bromo-3-pyridinyl)-2-hydroxypropanoic acid
CID 124595657
(2S)-2-hydroxy-3-(4-propan-2-ylphenyl)propanoic acid
CID 39241972

Frequently Asked Questions

What is the IUPAC name of 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid?
The IUPAC name of 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid (CID 139243425) is 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid.
What is the SMILES notation for 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid?
The canonical SMILES for 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid is O=C(O)C(O)Cc1cc(O)cc(O)c1.
What is the InChIKey of 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid?
The InChIKey is DFCPGQYAWGWUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8,10-12H,3H2,(H,13,14).
What are the key properties of 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid?
3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid has a molecular weight of 198.17 g/mol, XLogP of 0.09, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dihydroxyphenyl)-2-hydroxypropanoic acid is sourced from PubChem (CID 139243425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).