C10H12O5 — CID 90820561
2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoic acid (PubChem CID 90820561) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoic acid.
| Compound Name | 2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 90820561 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoic acid |
| SMILES | O=C(O)C(O)Cc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C10H12O5/c11-5-7-3-6(1-2-8(7)12)4-9(13)10(14)15/h1-3,9,11-13H,4-5H2,(H,14,15) |
| InChIKey | YVLXLQCSYPILDX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |