C14H18O5 — CID 131837143
3-[3-[(3,3-dimethyloxiran-2-yl)methyl]-4-hydroxyphenyl]-2-hydroxypropanoic acid (PubChem CID 131837143) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-[3-[(3,3-dimethyloxiran-2-yl)methyl]-4-hydroxyphenyl]-2-hydroxypropanoic acid.
| Compound Name | 3-[3-[(3,3-dimethyloxiran-2-yl)methyl]-4-hydroxyphenyl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 131837143 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-[3-[(3,3-dimethyloxiran-2-yl)methyl]-4-hydroxyphenyl]-2-hydroxypropanoic acid |
| SMILES | CC1(C)OC1Cc1cc(CC(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C14H18O5/c1-14(2)12(19-14)7-9-5-8(3-4-10(9)15)6-11(16)13(17)18/h3-5,11-12,15-16H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | LMTXUJRDHMJNMY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|