C10H9BrClNO2S — CID 102845170
2-[(4-bromo-5-chlorothiophen-2-yl)methyl-prop-2-ynylamino]acetic acid (PubChem CID 102845170) has the molecular formula C10H9BrClNO2S and a molecular weight of 322.61 g/mol. Its IUPAC name is 2-[(4-bromo-5-chlorothiophen-2-yl)methyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(4-bromo-5-chlorothiophen-2-yl)methyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 102845170 |
| Molecular Formula | C10H9BrClNO2S |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 320.92 |
| IUPAC Name | 2-[(4-bromo-5-chlorothiophen-2-yl)methyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)Cc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C10H9BrClNO2S/c1-2-3-13(6-9(14)15)5-7-4-8(11)10(12)16-7/h1,4H,3,5-6H2,(H,14,15) |
| InChIKey | YUOIACKXVGDNNF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|