2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid

C12H11Cl2NO2 — CID 79283542

IUPAC2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid
SMILESC#CCN(CC(=O)O)Cc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C12H11Cl2NO2/c1-2-3-15(8-12(16)17)7-9-4-10(13)6-11(14)5-9/h1,4-6H,3,7-8H2,(H,16,17)
InChIKeyGCRHEKXEKASHSM-UHFFFAOYSA-N
MW272.13 g/mol
LogP2.51
Rot. Bonds5

About 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid

2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid (PubChem CID 79283542) has the molecular formula C12H11Cl2NO2 and a molecular weight of 272.13 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid.

Molecular Properties

Compound Name2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid
PubChem CID79283542
Molecular FormulaC12H11Cl2NO2
Molecular Weight272.13 g/mol
Exact Mass271.02
IUPAC Name2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid
SMILESC#CCN(CC(=O)O)Cc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C12H11Cl2NO2/c1-2-3-15(8-12(16)17)7-9-4-10(13)6-11(14)5-9/h1,4-6H,3,7-8H2,(H,16,17)
InChIKeyGCRHEKXEKASHSM-UHFFFAOYSA-N
XLogP2.51
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.13
LogP ≤ 52.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid?
The IUPAC name of 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid (CID 79283542) is 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid.
What is the SMILES notation for 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid?
The canonical SMILES for 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid is C#CCN(CC(=O)O)Cc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid?
The InChIKey is GCRHEKXEKASHSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2NO2/c1-2-3-15(8-12(16)17)7-9-4-10(13)6-11(14)5-9/h1,4-6H,3,7-8H2,(H,16,17).
What are the key properties of 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid?
2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid has a molecular weight of 272.13 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid is sourced from PubChem (CID 79283542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).