C12H11Cl2NO2 — CID 79283542
2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid (PubChem CID 79283542) has the molecular formula C12H11Cl2NO2 and a molecular weight of 272.13 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79283542 |
| Molecular Formula | C12H11Cl2NO2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2NO2/c1-2-3-15(8-12(16)17)7-9-4-10(13)6-11(14)5-9/h1,4-6H,3,7-8H2,(H,16,17) |
| InChIKey | GCRHEKXEKASHSM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|