C13H13Cl2NO2S — CID 79274387
2-[2-(2,5-dichlorophenyl)sulfanylethyl-prop-2-ynylamino]acetic acid (PubChem CID 79274387) has the molecular formula C13H13Cl2NO2S and a molecular weight of 318.23 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)sulfanylethyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[2-(2,5-dichlorophenyl)sulfanylethyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79274387 |
| Molecular Formula | C13H13Cl2NO2S |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)sulfanylethyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CCSc1cc(Cl)ccc1Cl)CC(=O)O |
| InChI | InChI=1S/C13H13Cl2NO2S/c1-2-5-16(9-13(17)18)6-7-19-12-8-10(14)3-4-11(12)15/h1,3-4,8H,5-7,9H2,(H,17,18) |
| InChIKey | HNDGILSJRCZLEW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|