C12H13NO4 — CID 79284326
2-[(3,4-dihydroxyphenyl)methyl-prop-2-ynylamino]acetic acid (PubChem CID 79284326) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methyl-prop-2-ynylamino]acetic acid.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methyl-prop-2-ynylamino]acetic acid |
|---|---|
| PubChem CID | 79284326 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methyl-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H13NO4/c1-2-5-13(8-12(16)17)7-9-3-4-10(14)11(15)6-9/h1,3-4,6,14-15H,5,7-8H2,(H,16,17) |
| InChIKey | NZEQIBQTFXOGSR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|