C15H15NO4 — CID 65056826
2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid (PubChem CID 65056826) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid.
| Compound Name | 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid |
|---|---|
| PubChem CID | 65056826 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO4/c17-13-7-6-11(8-14(13)18)9-16(10-15(19)20)12-4-2-1-3-5-12/h1-8,17-18H,9-10H2,(H,19,20) |
| InChIKey | XXXZZPQJIOTQNQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|