2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid

C15H15NO4 — CID 65056826

IUPAC2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid
SMILESO=C(O)CN(Cc1ccc(O)c(O)c1)c1ccccc1
InChIInChI=1S/C15H15NO4/c17-13-7-6-11(8-14(13)18)9-16(10-15(19)20)12-4-2-1-3-5-12/h1-8,17-18H,9-10H2,(H,19,20)
InChIKeyXXXZZPQJIOTQNQ-UHFFFAOYSA-N
MW273.29 g/mol
LogP2.19
Rot. Bonds5

About 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid

2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid (PubChem CID 65056826) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid.

Molecular Properties

Compound Name2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid
PubChem CID65056826
Molecular FormulaC15H15NO4
Molecular Weight273.29 g/mol
Exact Mass273.10
IUPAC Name2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid
SMILESO=C(O)CN(Cc1ccc(O)c(O)c1)c1ccccc1
InChIInChI=1S/C15H15NO4/c17-13-7-6-11(8-14(13)18)9-16(10-15(19)20)12-4-2-1-3-5-12/h1-8,17-18H,9-10H2,(H,19,20)
InChIKeyXXXZZPQJIOTQNQ-UHFFFAOYSA-N
XLogP2.19
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.29
LogP ≤ 52.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid?
The IUPAC name of 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid (CID 65056826) is 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid.
What is the SMILES notation for 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid?
The canonical SMILES for 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid is O=C(O)CN(Cc1ccc(O)c(O)c1)c1ccccc1.
What is the InChIKey of 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid?
The InChIKey is XXXZZPQJIOTQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4/c17-13-7-6-11(8-14(13)18)9-16(10-15(19)20)12-4-2-1-3-5-12/h1-8,17-18H,9-10H2,(H,19,20).
What are the key properties of 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid?
2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid has a molecular weight of 273.29 g/mol, XLogP of 2.19, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-[(3,4-dihydroxyphenyl)methyl]anilino]acetic acid is sourced from PubChem (CID 65056826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).