C21H17NO6 — CID 122189604
4-[[carboxymethyl(naphthalen-2-yl)amino]methyl]phthalic acid (PubChem CID 122189604) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 4-[[carboxymethyl(naphthalen-2-yl)amino]methyl]phthalic acid.
| Compound Name | 4-[[carboxymethyl(naphthalen-2-yl)amino]methyl]phthalic acid |
|---|---|
| PubChem CID | 122189604 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-[[carboxymethyl(naphthalen-2-yl)amino]methyl]phthalic acid |
| SMILES | O=C(O)CN(Cc1ccc(C(=O)O)c(C(=O)O)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H17NO6/c23-19(24)12-22(16-7-6-14-3-1-2-4-15(14)10-16)11-13-5-8-17(20(25)26)18(9-13)21(27)28/h1-10H,11-12H2,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | HWFIKVFTSMGSPB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |