C19H16F3NO7 — CID 122189632
4-[[carboxymethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]methyl]phthalic acid (PubChem CID 122189632) has the molecular formula C19H16F3NO7 and a molecular weight of 427.33 g/mol. Its IUPAC name is 4-[[carboxymethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]methyl]phthalic acid.
| Compound Name | 4-[[carboxymethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]methyl]phthalic acid |
|---|---|
| PubChem CID | 122189632 |
| Molecular Formula | C19H16F3NO7 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-[[carboxymethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]methyl]phthalic acid |
| SMILES | O=C(O)CN(Cc1cccc(OC(F)(F)F)c1)Cc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H16F3NO7/c20-19(21,22)30-13-3-1-2-11(6-13)8-23(10-16(24)25)9-12-4-5-14(17(26)27)15(7-12)18(28)29/h1-7H,8-10H2,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | QMIVEXNROISARU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |