C13H13NO7 — CID 126649721
4-[[acetyl(carboxymethyl)amino]methyl]phthalic acid (PubChem CID 126649721) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is 4-[[acetyl(carboxymethyl)amino]methyl]phthalic acid.
| Compound Name | 4-[[acetyl(carboxymethyl)amino]methyl]phthalic acid |
|---|---|
| PubChem CID | 126649721 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4-[[acetyl(carboxymethyl)amino]methyl]phthalic acid |
| SMILES | CC(=O)N(CC(=O)O)Cc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H13NO7/c1-7(15)14(6-11(16)17)5-8-2-3-9(12(18)19)10(4-8)13(20)21/h2-4H,5-6H2,1H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | PZANJLCNRJANSP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |