C17H20N2O8 — CID 121418908
4-[[1-[acetyl(carboxymethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]phthalic acid (PubChem CID 121418908) has the molecular formula C17H20N2O8 and a molecular weight of 380.35 g/mol. Its IUPAC name is 4-[[1-[acetyl(carboxymethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]phthalic acid.
| Compound Name | 4-[[1-[acetyl(carboxymethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]phthalic acid |
|---|---|
| PubChem CID | 121418908 |
| Molecular Formula | C17H20N2O8 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-[[1-[acetyl(carboxymethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]phthalic acid |
| SMILES | CC(=O)N(CC(=O)O)C(=O)C(Nc1ccc(C(=O)O)c(C(=O)O)c1)C(C)C |
| InChI | InChI=1S/C17H20N2O8/c1-8(2)14(15(23)19(9(3)20)7-13(21)22)18-10-4-5-11(16(24)25)12(6-10)17(26)27/h4-6,8,14,18H,7H2,1-3H3,(H,21,22)(H,24,25)(H,26,27) |
| InChIKey | NGRUNJSYQDTFGI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |