C8H9BrClNO2S — CID 102844923
2-[(4-bromo-5-chlorothiophen-2-yl)methyl-methylamino]acetic acid (PubChem CID 102844923) has the molecular formula C8H9BrClNO2S and a molecular weight of 298.59 g/mol. Its IUPAC name is 2-[(4-bromo-5-chlorothiophen-2-yl)methyl-methylamino]acetic acid.
| Compound Name | 2-[(4-bromo-5-chlorothiophen-2-yl)methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 102844923 |
| Molecular Formula | C8H9BrClNO2S |
| Molecular Weight | 298.59 g/mol |
| Exact Mass | 296.92 |
| IUPAC Name | 2-[(4-bromo-5-chlorothiophen-2-yl)methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)Cc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C8H9BrClNO2S/c1-11(4-7(12)13)3-5-2-6(9)8(10)14-5/h2H,3-4H2,1H3,(H,12,13) |
| InChIKey | DKOABMGERAFEKJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |