C12H13F2N3O2 — CID 106235036
2-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethoxy]acetamide (PubChem CID 106235036) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106235036 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-[2-[(4-cyano-2,6-difluorophenyl)methylamino]ethoxy]acetamide |
| SMILES | N#Cc1cc(F)c(CNCCOCC(N)=O)c(F)c1 |
| InChI | InChI=1S/C12H13F2N3O2/c13-10-3-8(5-15)4-11(14)9(10)6-17-1-2-19-7-12(16)18/h3-4,17H,1-2,6-7H2,(H2,16,18) |
| InChIKey | XFEDGXKBUHKGEV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|