C12H12F3N — CID 103793243
N-[(2,4,5-trifluorophenyl)methyl]pent-4-yn-2-amine (PubChem CID 103793243) has the molecular formula C12H12F3N and a molecular weight of 227.23 g/mol. Its IUPAC name is N-[(2,4,5-trifluorophenyl)methyl]pent-4-yn-2-amine.
| Compound Name | N-[(2,4,5-trifluorophenyl)methyl]pent-4-yn-2-amine |
|---|---|
| PubChem CID | 103793243 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-[(2,4,5-trifluorophenyl)methyl]pent-4-yn-2-amine |
| SMILES | C#CCC(C)NCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H12F3N/c1-3-4-8(2)16-7-9-5-11(14)12(15)6-10(9)13/h1,5-6,8,16H,4,7H2,2H3 |
| InChIKey | OYXAKBXRVBIUFF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|