C10H12F3NO2 — CID 115732638
2-[(2,4,5-trifluorophenyl)methylamino]propane-1,3-diol (PubChem CID 115732638) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-[(2,4,5-trifluorophenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(2,4,5-trifluorophenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 115732638 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(2,4,5-trifluorophenyl)methylamino]propane-1,3-diol |
| SMILES | OCC(CO)NCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H12F3NO2/c11-8-2-10(13)9(12)1-6(8)3-14-7(4-15)5-16/h1-2,7,14-16H,3-5H2 |
| InChIKey | ZAIOJHAVXDXAOS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|