C12H15F3N2O — CID 103792586
N,N-dimethyl-2-[(2,4,5-trifluorophenyl)methylamino]propanamide (PubChem CID 103792586) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2,4,5-trifluorophenyl)methylamino]propanamide.
| Compound Name | N,N-dimethyl-2-[(2,4,5-trifluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 103792586 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N,N-dimethyl-2-[(2,4,5-trifluorophenyl)methylamino]propanamide |
| SMILES | CC(NCc1cc(F)c(F)cc1F)C(=O)N(C)C |
| InChI | InChI=1S/C12H15F3N2O/c1-7(12(18)17(2)3)16-6-8-4-10(14)11(15)5-9(8)13/h4-5,7,16H,6H2,1-3H3 |
| InChIKey | AKEWDXLCHXTAAC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|