C13H14F3N — CID 114202121
4-methyl-N-[(2,4,5-trifluorophenyl)methyl]pent-1-yn-3-amine (PubChem CID 114202121) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is 4-methyl-N-[(2,4,5-trifluorophenyl)methyl]pent-1-yn-3-amine.
| Compound Name | 4-methyl-N-[(2,4,5-trifluorophenyl)methyl]pent-1-yn-3-amine |
|---|---|
| PubChem CID | 114202121 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-methyl-N-[(2,4,5-trifluorophenyl)methyl]pent-1-yn-3-amine |
| SMILES | C#CC(NCc1cc(F)c(F)cc1F)C(C)C |
| InChI | InChI=1S/C13H14F3N/c1-4-13(8(2)3)17-7-9-5-11(15)12(16)6-10(9)14/h1,5-6,8,13,17H,7H2,2-3H3 |
| InChIKey | XEBPCHJFDIRKLY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|